cas: 150349-65-8 — see every product listed under this CAS number, including other names
tert-Butyl 4-(3-aminopropyl)piperidine-1-carboxylate, 97% (CAS 150349-65-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F446290-100MG |
| cas | 150349-65-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 627.92 Pln | |
| Fluorochem | 5g | 2793.83 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 4-(3-aminopropyl)piperidine-1-carboxylate (CAS 150349-65-8) is a chemical compound with the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. IUPAC name: tert-butyl 4-(3-aminopropyl)piperidine-1-carboxylate. InChIKey: QZYIDMYWRACBRQ-UHFFFAOYSA-N.
| Molecular formula | C13H26N2O2 |
|---|---|
| Molecular weight | 242.36 g/mol |
| IUPAC name | tert-butyl 4-(3-aminopropyl)piperidine-1-carboxylate |
| InChIKey | QZYIDMYWRACBRQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CCCN |
Computed by PubChem (NCBI)