cas: 1187386-01-1 — see every product listed under this CAS number, including other names
tert-Butyl 4-(3-bromopyridin-2-yl)piperazine-1-carboxylate 98% (CAS 1187386-01-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A596533-1g |
| cas | 1187386-01-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 637.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A596533 |
Tert-butyl 4-(3-bromo-2-pyridinyl)piperazine-1-carboxylate (CAS 1187386-01-1) is a chemical compound with the molecular formula C14H20BrN3O2 and a molecular weight of 342.23 g/mol. IUPAC name: tert-butyl 4-(3-bromo-2-pyridinyl)piperazine-1-carboxylate. InChIKey: FCYPZKOIXIHNRE-UHFFFAOYSA-N.
| Molecular formula | C14H20BrN3O2 |
|---|---|
| Molecular weight | 342.23 g/mol |
| IUPAC name | tert-butyl 4-(3-bromo-2-pyridinyl)piperazine-1-carboxylate |
| InChIKey | FCYPZKOIXIHNRE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=C(C=CC=N2)Br |
Computed by PubChem (NCBI)