cas: 156185-63-6 — see every product listed under this CAS number, including other names
tert-Butyl 4-(3-hydroxypropyl)tetrahydro-1(2H)-pyridinecarboxylate 98% (CAS 156185-63-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A165055-250mg |
| cas | 156185-63-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 10g | 537.25 Pln | |
| Ambeed | 25g | 1043.44 Pln | |
| Ambeed | 100g | 3963.75 Pln | |
| Ambeed | 500g | 15633.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A165055 |
Tert-butyl 4-(3-hydroxypropyl)piperidine-1-carboxylate (CAS 156185-63-6) is a chemical compound with the molecular formula C13H25NO3 and a molecular weight of 243.34 g/mol. IUPAC name: tert-butyl 4-(3-hydroxypropyl)piperidine-1-carboxylate. InChIKey: OXPWHPCCUXESFQ-UHFFFAOYSA-N.
| Molecular formula | C13H25NO3 |
|---|---|
| Molecular weight | 243.34 g/mol |
| IUPAC name | tert-butyl 4-(3-hydroxypropyl)piperidine-1-carboxylate |
| InChIKey | OXPWHPCCUXESFQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CCCO |
Computed by PubChem (NCBI)