cas: 158985-37-6 — see every product listed under this CAS number, including other names
tert-Butyl 4-(4-(hydroxymethyl)phenyl)piperazine-1-carboxylate, 98% (CAS 158985-37-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F609819-250MG |
| cas | 158985-37-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 5g | 1028.82 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-[4-(hydroxymethyl)phenyl]piperazine-1-carboxylate (CAS 158985-37-6) is a chemical compound with the molecular formula C16H24N2O3 and a molecular weight of 292.37 g/mol. IUPAC name: tert-butyl 4-[4-(hydroxymethyl)phenyl]piperazine-1-carboxylate. InChIKey: PXKYXTXYWJKTSQ-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O3 |
|---|---|
| Molecular weight | 292.37 g/mol |
| IUPAC name | tert-butyl 4-[4-(hydroxymethyl)phenyl]piperazine-1-carboxylate |
| InChIKey | PXKYXTXYWJKTSQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)