cas: 869901-02-0 — see every product listed under this CAS number, including other names
tert-Butyl 4-(4-formylthiazol-2-yl)piperidine-1-carboxylate, 97%, 97% (CAS 869901-02-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115NWU-100mg |
| cas | 869901-02-0 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 250mg | 616.40 Pln | |
| Chemat | 1g | 1326.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(4-formyl-1,3-thiazol-2-yl)piperidine-1-carboxylate (CAS 869901-02-0) is a chemical compound with the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. IUPAC name: tert-butyl 4-(4-formyl-1,3-thiazol-2-yl)piperidine-1-carboxylate. InChIKey: XLGKMJFDRZHAEV-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O3S |
|---|---|
| Molecular weight | 296.39 g/mol |
| IUPAC name | tert-butyl 4-(4-formyl-1,3-thiazol-2-yl)piperidine-1-carboxylate |
| InChIKey | XLGKMJFDRZHAEV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=NC(=CS2)C=O |
Computed by PubChem (NCBI)