cas: 153747-97-8 — see every product listed under this CAS number, including other names
tert-Butyl 4-(5-bromopyridin-2-yl)piperazine-1-carboxylate 96% (CAS 153747-97-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A180382-250mg |
| cas | 153747-97-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 348.12 Pln | |
| Ambeed | 100g | 1176.94 Pln | |
| Ambeed | 500g | 5588.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A180382 |
Tert-butyl 4-(5-bromo-2-pyridinyl)piperazine-1-carboxylate (CAS 153747-97-8) is a chemical compound with the molecular formula C14H20BrN3O2 and a molecular weight of 342.23 g/mol. IUPAC name: tert-butyl 4-(5-bromo-2-pyridinyl)piperazine-1-carboxylate. InChIKey: DSLVSFMWCDGZIL-UHFFFAOYSA-N.
| Molecular formula | C14H20BrN3O2 |
|---|---|
| Molecular weight | 342.23 g/mol |
| IUPAC name | tert-butyl 4-(5-bromo-2-pyridinyl)piperazine-1-carboxylate |
| InChIKey | DSLVSFMWCDGZIL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)