cas: 1198408-35-3 — see every product listed under this CAS number, including other names
tert-Butyl 4-(6-aminopyridin-3-yl)piperidine-1-carboxylate 95% (CAS 1198408-35-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A331079-250mg |
| cas | 1198408-35-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 743.06 Pln | |
| Ambeed | 25g | 3424.19 Pln | |
| Ambeed | 100g | 10794.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A331079 |
Tert-butyl 4-(6-amino-3-pyridinyl)piperidine-1-carboxylate (CAS 1198408-35-3) is a chemical compound with the molecular formula C15H23N3O2 and a molecular weight of 277.36 g/mol. IUPAC name: tert-butyl 4-(6-amino-3-pyridinyl)piperidine-1-carboxylate. InChIKey: UGJYTOMOCDGLRS-UHFFFAOYSA-N.
| Molecular formula | C15H23N3O2 |
|---|---|
| Molecular weight | 277.36 g/mol |
| IUPAC name | tert-butyl 4-(6-amino-3-pyridinyl)piperidine-1-carboxylate |
| InChIKey | UGJYTOMOCDGLRS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CN=C(C=C2)N |
Computed by PubChem (NCBI)