cas: 1198408-35-3 — see every product listed under this CAS number, including other names
TERT-BUTYL 4-(6-AMINOPYRIDIN-3-YL)PIPERIDINE-1-CARBOXYLATE, 95% (CAS 1198408-35-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F333817-1G |
| cas | 1198408-35-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 685.19 Pln | |
| Fluorochem | 25g | 2767.79 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 4-(6-amino-3-pyridinyl)piperidine-1-carboxylate (CAS 1198408-35-3) is a chemical compound with the molecular formula C15H23N3O2 and a molecular weight of 277.36 g/mol. IUPAC name: tert-butyl 4-(6-amino-3-pyridinyl)piperidine-1-carboxylate. InChIKey: UGJYTOMOCDGLRS-UHFFFAOYSA-N.
| Molecular formula | C15H23N3O2 |
|---|---|
| Molecular weight | 277.36 g/mol |
| IUPAC name | tert-butyl 4-(6-amino-3-pyridinyl)piperidine-1-carboxylate |
| InChIKey | UGJYTOMOCDGLRS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CN=C(C=C2)N |
Computed by PubChem (NCBI)