cas: 1303973-22-9 — see every product listed under this CAS number, including other names
tert-Butyl 4-(aminomethyl)-3,3-difluoropiperidine-1-carboxylate, 97%, 97% (CAS 1303973-22-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11A4GX-100mg |
| cas | 1303973-22-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 1154.00 Pln | |
| Chemat | 5g | 5205.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(aminomethyl)-3,3-difluoropiperidine-1-carboxylate (CAS 1303973-22-9) is a chemical compound with the molecular formula C11H20F2N2O2 and a molecular weight of 250.29 g/mol. IUPAC name: tert-butyl 4-(aminomethyl)-3,3-difluoropiperidine-1-carboxylate. InChIKey: WYFLAUNQWVXXHB-UHFFFAOYSA-N.
| Molecular formula | C11H20F2N2O2 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | tert-butyl 4-(aminomethyl)-3,3-difluoropiperidine-1-carboxylate |
| InChIKey | WYFLAUNQWVXXHB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)(F)F)CN |
Computed by PubChem (NCBI)