cas: 139290-70-3 — see every product listed under this CAS number, including other names
tert-Butyl 4-(methoxy(methyl)carbamoyl)piperidine-1-carboxylate, 98%, 98% (CAS 139290-70-3) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114E2R-50g |
| cas | 139290-70-3 |
| size | 50g |
| availability | 1134.8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 170.00 Pln | |
| Chemat | 250g | 558.80 Pln | |
| Chemat | 100mg | 69.20 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 100g | 270.80 Pln | |
| Chemat | 500g | 1099.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-[methoxy(methyl)carbamoyl]piperidine-1-carboxylate (CAS 139290-70-3) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: tert-butyl 4-[methoxy(methyl)carbamoyl]piperidine-1-carboxylate. InChIKey: ITCQNWXLNZGEHP-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | tert-butyl 4-[methoxy(methyl)carbamoyl]piperidine-1-carboxylate |
| InChIKey | ITCQNWXLNZGEHP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(=O)N(C)OC |
Computed by PubChem (NCBI)