cas: 879883-54-2 — see every product listed under this CAS number, including other names
tert-Butyl 4-(piperidin-4-ylmethyl)piperidine-1-carboxylate, 97%, 97% (CAS 879883-54-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g, 100g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H444-100mg |
| cas | 879883-54-2 |
| size | 100mg |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 500mg | 371.60 Pln | |
| Chemat | 1g | 510.80 Pln | |
| Chemat | 5g | 1715.60 Pln | |
| Chemat | 25g | 6266.00 Pln | |
| Chemat | 100g | 12976.40 Pln | |
| Chemat | 10g | 2819.60 Pln | |
| Chemat | 50g | 8176.40 Pln | |
| Chemat | 250g | 28115.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(piperidin-4-ylmethyl)piperidine-1-carboxylate (CAS 879883-54-2) is a chemical compound with the molecular formula C16H30N2O2 and a molecular weight of 282.42 g/mol. IUPAC name: tert-butyl 4-(piperidin-4-ylmethyl)piperidine-1-carboxylate. InChIKey: JFKOSNRSLHVFMJ-UHFFFAOYSA-N.
| Molecular formula | C16H30N2O2 |
|---|---|
| Molecular weight | 282.42 g/mol |
| IUPAC name | tert-butyl 4-(piperidin-4-ylmethyl)piperidine-1-carboxylate |
| InChIKey | JFKOSNRSLHVFMJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CC2CCNCC2 |
Computed by PubChem (NCBI)