cas: 301185-41-1 — see every product listed under this CAS number, including other names
tert-Butyl 4-(prop-2-yn-1-yl)piperidine-1-carboxylate, 97.0% (CAS 301185-41-1) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 25 g, 500 mg, 250 mg, 5 g, 10 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W076878-100 mg |
| cas | 301185-41-1 |
| size | 100 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 287.18 Pln | |
| MedChemExpress | 25 g | 11000.89 Pln | |
| MedChemExpress | 500 mg | 579.76 Pln | |
| MedChemExpress | 250 mg | 407.93 Pln | |
| MedChemExpress | 5 g | 2855.32 Pln | |
| MedChemExpress | 10 g | 4652.54 Pln | |
| MedChemExpress | 1 g | 863.04 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 97.0% |
Tert-butyl 4-prop-2-ynylpiperidine-1-carboxylate (CAS 301185-41-1) is a chemical compound with the molecular formula C13H21NO2 and a molecular weight of 223.31 g/mol. IUPAC name: tert-butyl 4-prop-2-ynylpiperidine-1-carboxylate. InChIKey: CHTFWVDBUXUMCE-UHFFFAOYSA-N.
| Molecular formula | C13H21NO2 |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | tert-butyl 4-prop-2-ynylpiperidine-1-carboxylate |
| InChIKey | CHTFWVDBUXUMCE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CC#C |
Computed by PubChem (NCBI)