cas: 492431-12-6 — see every product listed under this CAS number, including other names
tert-Butyl 4-(pyridazin-3-yl)piperazine-1-carboxylate 98% (CAS 492431-12-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A161604-250mg |
| cas | 492431-12-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 665.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A161604 |
Tert-butyl 4-pyridazin-3-ylpiperazine-1-carboxylate (CAS 492431-12-6) is a chemical compound with the molecular formula C13H20N4O2 and a molecular weight of 264.32 g/mol. IUPAC name: tert-butyl 4-pyridazin-3-ylpiperazine-1-carboxylate. InChIKey: KNCRBGIXAOVMQM-UHFFFAOYSA-N.
| Molecular formula | C13H20N4O2 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | tert-butyl 4-pyridazin-3-ylpiperazine-1-carboxylate |
| InChIKey | KNCRBGIXAOVMQM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NN=CC=C2 |
Computed by PubChem (NCBI)