cas: 1311200-05-1 — see every product listed under this CAS number, including other names
tert-Butyl 4-amino-2-(trifluoromethyl)benzoate, 96% (CAS 1311200-05-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A412384-25g |
| cas | 1311200-05-1 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 6918.52 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 857.01 Pln | |
| Fluorochem | 10g | 1658.81 Pln | |
| Fluorochem | 25g | 4069.42 Pln |
| purity | 96% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 4-amino-2-(trifluoromethyl)benzoate (CAS 1311200-05-1) is a chemical compound with the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. IUPAC name: tert-butyl 4-amino-2-(trifluoromethyl)benzoate. InChIKey: CLJQXSMSVHCCST-UHFFFAOYSA-N.
| Molecular formula | C12H14F3NO2 |
|---|---|
| Molecular weight | 261.24 g/mol |
| IUPAC name | tert-butyl 4-amino-2-(trifluoromethyl)benzoate |
| InChIKey | CLJQXSMSVHCCST-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)