cas: 1260639-98-2 — see every product listed under this CAS number, including other names
tert-Butyl 4-amino-3-methoxypiperidine-1-carboxylate 98% (CAS 1260639-98-2) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A153934-25mg |
| cas | 1260639-98-2 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 637.38 Pln | |
| Ambeed | 50mg | 843.19 Pln | |
| Ambeed | 100mg | 1321.56 Pln | |
| Ambeed | 250mg | 2167.06 Pln | |
| Ambeed | 1g | 5560.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A153934 |
Tert-butyl 4-amino-3-methoxypiperidine-1-carboxylate (CAS 1260639-98-2) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl 4-amino-3-methoxypiperidine-1-carboxylate. InChIKey: QNGHCFVWYKWWMU-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl 4-amino-3-methoxypiperidine-1-carboxylate |
| InChIKey | QNGHCFVWYKWWMU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)OC)N |
Computed by PubChem (NCBI)