cas: 57260-70-5 — see every product listed under this CAS number, including other names
tert-Butyl 4-benzylpiperazine-1-carboxylate, 98% (CAS 57260-70-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F791026-5G |
| cas | 57260-70-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 10g | 221.81 Pln | |
| Fluorochem | 25g | 450.90 Pln | |
| Fluorochem | 100g | 1320.39 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-benzylpiperazine-1-carboxylate (CAS 57260-70-5) is a chemical compound with the molecular formula C16H24N2O2 and a molecular weight of 276.37 g/mol. IUPAC name: tert-butyl 4-benzylpiperazine-1-carboxylate. InChIKey: GVHSMUYEAWMYLM-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O2 |
|---|---|
| Molecular weight | 276.37 g/mol |
| IUPAC name | tert-butyl 4-benzylpiperazine-1-carboxylate |
| InChIKey | GVHSMUYEAWMYLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)