cas: 153836-14-7 — see every product listed under this CAS number, including other names
tert-Butyl 4-carbamimidoylpiperazine-1-carboxylate, 98%+(HPLC),RG, 98%+(HPLC),RG (CAS 153836-14-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AKEK-100mg |
| cas | 153836-14-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 914.00 Pln | |
| Chemat | 1g | 2253.20 Pln | |
| Chemat | 5g | 10590.80 Pln |
| purity | 98%+(HPLC),RG |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-carbamimidoylpiperazine-1-carboxylate (CAS 153836-14-7) is a chemical compound with the molecular formula C10H20N4O2 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl 4-carbamimidoylpiperazine-1-carboxylate. InChIKey: MJNAHJKRZWPBSX-UHFFFAOYSA-N.
| Molecular formula | C10H20N4O2 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl 4-carbamimidoylpiperazine-1-carboxylate |
| InChIKey | MJNAHJKRZWPBSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(=N)N |
Computed by PubChem (NCBI)