cas: 153836-14-7 — see every product listed under this CAS number, including other names
tert-Butyl 4-carbamimidoylpiperazine-1-carboxylate (CAS 153836-14-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F050595-100MG |
| cas | 153836-14-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 825.77 Pln | |
| Fluorochem | 250mg | 1486.99 Pln | |
| Fluorochem | 1g | 3704.96 Pln | |
| Fluorochem | 5g | 17512.60 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl 4-carbamimidoylpiperazine-1-carboxylate (CAS 153836-14-7) is a chemical compound with the molecular formula C10H20N4O2 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl 4-carbamimidoylpiperazine-1-carboxylate. InChIKey: MJNAHJKRZWPBSX-UHFFFAOYSA-N.
| Molecular formula | C10H20N4O2 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl 4-carbamimidoylpiperazine-1-carboxylate |
| InChIKey | MJNAHJKRZWPBSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(=N)N |
Computed by PubChem (NCBI)