cas: 614730-96-0 — see every product listed under this CAS number, including other names
tert-Butyl 4-cyano-4-(hydroxymethyl)piperidine-1-carboxylate, 97%, 97% (CAS 614730-96-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ECPQ-100mg |
| cas | 614730-96-0 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1302.80 Pln | |
| Chemat | 25g | 2541.20 Pln | |
| Chemat | 50g | 4058.00 Pln | |
| Chemat | 100g | 6952.40 Pln | |
| Chemat | 250g | 8915.60 Pln | |
| Chemat | 500g | 15998.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-cyano-4-(hydroxymethyl)piperidine-1-carboxylate (CAS 614730-96-0) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl 4-cyano-4-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: BLZNRLWYSXQYLO-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl 4-cyano-4-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | BLZNRLWYSXQYLO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(CO)C#N |
Computed by PubChem (NCBI)