cas: 1334413-33-0 — see every product listed under this CAS number, including other names
tert-Butyl 4-fluoro-3-oxopiperidine-1-carboxylate, 95% (CAS 1334413-33-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 50mg, 100mg. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QW-2632-1g |
| cas | 1334413-33-0 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 250mg | 3168.69 Pln | |
| Fluorochem | 1g | 10369.28 Pln | |
| Fluorochem | 5g | 48975.48 Pln | |
| Ambeed | 50mg | 631.81 Pln | |
| Ambeed | 250mg | 1922.31 Pln | |
| Ambeed | 1g | 5754.88 Pln | |
| Chemat | 50mg | 827.60 Pln | |
| Chemat | 100mg | 1365.20 Pln | |
| Chemat | 250mg | 2594.00 Pln | |
| Chemat | 1g | 8738.00 Pln | |
| Chemat | 5g | 34763.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Tert-butyl 4-fluoro-3-oxopiperidine-1-carboxylate (CAS 1334413-33-0) is a chemical compound with the molecular formula C10H16FNO3 and a molecular weight of 217.24 g/mol. IUPAC name: tert-butyl 4-fluoro-3-oxopiperidine-1-carboxylate. InChIKey: ZRQXQCQSKSYTBU-UHFFFAOYSA-N.
| Molecular formula | C10H16FNO3 |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | tert-butyl 4-fluoro-3-oxopiperidine-1-carboxylate |
| InChIKey | ZRQXQCQSKSYTBU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)C1)F |
Computed by PubChem (NCBI)