cas: 1207194-48-6 — see every product listed under this CAS number, including other names
tert-Butyl 4-formylindoline-1-carboxylate, 97%, 97% (CAS 1207194-48-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114E2Y-100mg |
| cas | 1207194-48-6 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 909.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-formyl-2,3-dihydroindole-1-carboxylate (CAS 1207194-48-6) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: tert-butyl 4-formyl-2,3-dihydroindole-1-carboxylate. InChIKey: FEAIDQMPFVVRKA-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | tert-butyl 4-formyl-2,3-dihydroindole-1-carboxylate |
| InChIKey | FEAIDQMPFVVRKA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C=CC=C21)C=O |
Computed by PubChem (NCBI)