cas: 1245646-10-9 — see every product listed under this CAS number, including other names
tert-Butyl 4-hydroxy-2-oxopiperidine-1-carboxylate, 95% (CAS 1245646-10-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077654-100MG |
| cas | 1245646-10-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 91.65 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 1106.92 Pln | |
| Fluorochem | 10g | 2122.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-hydroxy-2-oxopiperidine-1-carboxylate (CAS 1245646-10-9) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: tert-butyl 4-hydroxy-2-oxopiperidine-1-carboxylate. InChIKey: KCUXWAQHQHPYFT-UHFFFAOYSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | tert-butyl 4-hydroxy-2-oxopiperidine-1-carboxylate |
| InChIKey | KCUXWAQHQHPYFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1=O)O |
Computed by PubChem (NCBI)