CAS 1624262-46-9 is the registry number for tert-Butyl 4-hydroxy-7,8-dihydropyrido[4',3':3,4]pyrazolo[1,5-a]pyrimidine-9(10h)-carboxylate, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg.
Tert-butyl 6-oxo-3,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4-triene-12-carboxylate (CAS 1624262-46-9) is a chemical compound with the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. IUPAC name: tert-butyl 6-oxo-3,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4-triene-12-carboxylate. InChIKey: UZEGGGMZHJWRML-UHFFFAOYSA-N.
| Molecular formula | C14H18N4O3 |
|---|---|
| Molecular weight | 290.32 g/mol |
| IUPAC name | tert-butyl 6-oxo-3,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4-triene-12-carboxylate |
| InChIKey | UZEGGGMZHJWRML-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C3=NC=CC(=O)N3N2 |
Computed by PubChem (NCBI)