cas: 179898-00-1 — see every product listed under this CAS number, including other names
tert-Butyl 4-oxo-3,4-dihydroquinoline-1(2H)-carboxylate, 97% (CAS 179898-00-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F318490-1G |
| cas | 179898-00-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 5g | 1294.35 Pln | |
| Fluorochem | 10g | 2236.73 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 4-oxo-2,3-dihydroquinoline-1-carboxylate (CAS 179898-00-1) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: tert-butyl 4-oxo-2,3-dihydroquinoline-1-carboxylate. InChIKey: UIFOUBFGWSHWLM-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | tert-butyl 4-oxo-2,3-dihydroquinoline-1-carboxylate |
| InChIKey | UIFOUBFGWSHWLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C2=CC=CC=C21 |
Computed by PubChem (NCBI)