cas: 188975-88-4 — see every product listed under this CAS number, including other names
tert-Butyl 4-oxoazepane-1-carboxylate, 95%, 95% (CAS 188975-88-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114STZ-250mg |
| cas | 188975-88-4 |
| size | 250mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 256.40 Pln | |
| Chemat | 100g | 717.20 Pln | |
| Chemat | 1kg | 6448.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-oxoazepane-1-carboxylate (CAS 188975-88-4) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl 4-oxoazepane-1-carboxylate. InChIKey: PMLBUVZPRKXMOX-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl 4-oxoazepane-1-carboxylate |
| InChIKey | PMLBUVZPRKXMOX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(=O)CC1 |
Computed by PubChem (NCBI)