cas: 864771-44-8 — see every product listed under this CAS number, including other names
tert-Butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate, 95%, 95% (CAS 864771-44-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11476R-100mg |
| cas | 864771-44-8 |
| size | 100mg |
| availability | 14.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 362.00 Pln | |
| Chemat | 10g | 664.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate (CAS 864771-44-8) is a chemical compound with the molecular formula C18H25BN2O4 and a molecular weight of 344.2 g/mol. IUPAC name: tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate. InChIKey: MMXDKXUKSKMROG-UHFFFAOYSA-N.
| Molecular formula | C18H25BN2O4 |
|---|---|
| Molecular weight | 344.2 g/mol |
| IUPAC name | tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate |
| InChIKey | MMXDKXUKSKMROG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N(N=C3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)