cas: 777061-36-6 — see every product listed under this CAS number, including other names
tert-Butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate, 96% (CAS 777061-36-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021627-1G |
| cas | 777061-36-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 25g | 1362.04 Pln | |
| Fluorochem | 100g | 4605.69 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 777061-36-6) is a chemical compound with the molecular formula C19H26BNO4 and a molecular weight of 343.2 g/mol. IUPAC name: tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: WPSDWNFTICAMNI-UHFFFAOYSA-N.
| Molecular formula | C19H26BNO4 |
|---|---|
| Molecular weight | 343.2 g/mol |
| IUPAC name | tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | WPSDWNFTICAMNI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N(C=C3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)