cas: 1356037-30-3 — see every product listed under this CAS number, including other names
tert-Butyl 5-bromo-3-methylpicolinate 98% (CAS 1356037-30-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A518084-100mg |
| cas | 1356037-30-3 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 531.69 Pln | |
| Ambeed | 5g | 1799.94 Pln | |
| Ambeed | 10g | 2834.56 Pln | |
| Ambeed | 25g | 5599.12 Pln | |
| Ambeed | 100g | 22186.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A518084 |
Tert-butyl 5-bromo-3-methylpyridine-2-carboxylate (CAS 1356037-30-3) is a chemical compound with the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. IUPAC name: tert-butyl 5-bromo-3-methylpyridine-2-carboxylate. InChIKey: VYEFIDLPUQXRNR-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | tert-butyl 5-bromo-3-methylpyridine-2-carboxylate |
| InChIKey | VYEFIDLPUQXRNR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)