cas: 2404734-24-1 — see every product listed under this CAS number, including other names
tert-Butyl 5-bromo-6-methylpicolinate (CAS 2404734-24-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627174-1G |
| cas | 2404734-24-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3455.05 Pln | |
| Fluorochem | 5g | 10233.91 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl 5-bromo-6-methylpyridine-2-carboxylate (CAS 2404734-24-1) is a chemical compound with the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. IUPAC name: tert-butyl 5-bromo-6-methylpyridine-2-carboxylate. InChIKey: BEULOLBWBKHNCB-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | tert-butyl 5-bromo-6-methylpyridine-2-carboxylate |
| InChIKey | BEULOLBWBKHNCB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)