tert-Butyl 5-hydroxytetrahydro-2H-pyran-2-carboxylate, 95%
cas: 1629145-46-5 — see every product listed under this CAS number, including other names
tert-Butyl 5-hydroxytetrahydro-2H-pyran-2-carboxylate, 95% (CAS 1629145-46-5) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1229195-10mg |
| cas | 1629145-46-5 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 381.50 Pln | |
| Ambeed | 25mg | 665.19 Pln | |
| Ambeed | 50mg | 1087.94 Pln | |
| Ambeed | 100mg | 1794.38 Pln | |
| Ambeed | 250mg | 2834.56 Pln | |
| Ambeed | 1g | 6973.06 Pln | |
| BLDpharm | 10mg | 408.77 Pln | |
| BLDpharm | 25mg | 714.22 Pln | |
| BLDpharm | 50mg | 1164.06 Pln | |
| BLDpharm | 100mg | 1930.46 Pln | |
| BLDpharm | 250mg | 3046.73 Pln | |
| BLDpharm | 1g | 7517.38 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 5-hydroxyoxane-2-carboxylate (CAS 1629145-46-5) is a chemical compound with the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl 5-hydroxyoxane-2-carboxylate. InChIKey: JCEFYRILUAFZKD-UHFFFAOYSA-N.
| Molecular formula | C10H18O4 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl 5-hydroxyoxane-2-carboxylate |
| InChIKey | JCEFYRILUAFZKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CCC(CO1)O |
Computed by PubChem (NCBI)