cas: 890839-29-9 — see every product listed under this CAS number, including other names
tert-Butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate, 97% (CAS 890839-29-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239455-100MG |
| cas | 890839-29-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 5g | 2080.54 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate (CAS 890839-29-9) is a chemical compound with the molecular formula C18H25BN2O4 and a molecular weight of 344.2 g/mol. IUPAC name: tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate. InChIKey: YUDDGOUBTYNGSF-UHFFFAOYSA-N.
| Molecular formula | C18H25BN2O4 |
|---|---|
| Molecular weight | 344.2 g/mol |
| IUPAC name | tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate |
| InChIKey | YUDDGOUBTYNGSF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=NN3C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)