cas: 1363381-93-4 — see every product listed under this CAS number, including other names
tert-Butyl 6-(hydroxymethyl)-2-azaspiro[3.3]heptane-2-carboxylate, 98.0% (CAS 1363381-93-4) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10 g, 25 g, 500 mg, 250 mg, 100 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W056318-5 g |
| cas | 1363381-93-4 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 5186.60 Pln | |
| MedChemExpress | 10 g | 7675.79 Pln | |
| MedChemExpress | 25 g | 13736.21 Pln | |
| MedChemExpress | 500 mg | 1485.34 Pln | |
| MedChemExpress | 250 mg | 1058.09 Pln | |
| MedChemExpress | 100 mg | 672.64 Pln | |
| MedChemExpress | 1 g | 2158.72 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
Tert-butyl 6-(hydroxymethyl)-2-azaspiro[3.3]heptane-2-carboxylate (CAS 1363381-93-4) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl 6-(hydroxymethyl)-2-azaspiro[3.3]heptane-2-carboxylate. InChIKey: DDYDRGNYVNDPNR-UHFFFAOYSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl 6-(hydroxymethyl)-2-azaspiro[3.3]heptane-2-carboxylate |
| InChIKey | DDYDRGNYVNDPNR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(C2)CO |
Computed by PubChem (NCBI)