cas: 93862-70-5 — see every product listed under this CAS number, including other names
tert-Butyl 6-bromo-3-formyl-1h-indole-1-carboxylate, 98%, 98% (CAS 93862-70-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHVK-100mg |
| cas | 93862-70-5 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 597.20 Pln | |
| Chemat | 250mg | 971.60 Pln | |
| Chemat | 1g | 2507.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 6-bromo-3-formylindole-1-carboxylate (CAS 93862-70-5) is a chemical compound with the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. IUPAC name: tert-butyl 6-bromo-3-formylindole-1-carboxylate. InChIKey: WDXGCKWHPVRYGA-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO3 |
|---|---|
| Molecular weight | 324.17 g/mol |
| IUPAC name | tert-butyl 6-bromo-3-formylindole-1-carboxylate |
| InChIKey | WDXGCKWHPVRYGA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=C(C=C2)Br)C=O |
Computed by PubChem (NCBI)