cas: 294659-72-6 — see every product listed under this CAS number, including other names
tert-Butyl 6-chloro-3-formylpyridin-2-ylcarbamate 98% (CAS 294659-72-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A842815-250mg |
| cas | 294659-72-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 2728.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A842815 |
Tert-butyl N-(6-chloro-3-formyl-2-pyridinyl)carbamate (CAS 294659-72-6) is a chemical compound with the molecular formula C11H13ClN2O3 and a molecular weight of 256.68 g/mol. IUPAC name: tert-butyl N-(6-chloro-3-formyl-2-pyridinyl)carbamate. InChIKey: BBWRRFRNWSKWFU-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O3 |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | tert-butyl N-(6-chloro-3-formyl-2-pyridinyl)carbamate |
| InChIKey | BBWRRFRNWSKWFU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=N1)Cl)C=O |
Computed by PubChem (NCBI)