Products 1021339-24-1

CAS 1021339-24-1 is the registry number for 2-Chloro-4-pivalamidonicotinic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-chloro-4-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid (CAS 1021339-24-1) is a chemical compound with the molecular formula C11H13ClN2O3 and a molecular weight of 256.68 g/mol. IUPAC name: 2-chloro-4-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid. InChIKey: FOGOGWIZSINXEC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13ClN2O3
Molecular weight256.68 g/mol
IUPAC name2-chloro-4-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid
InChIKeyFOGOGWIZSINXEC-UHFFFAOYSA-N
SMILESCC(C)(C)C(=O)NC1=C(C(=NC=C1)Cl)C(=O)O

Computed by PubChem (NCBI)