CAS 1021339-24-1 is the registry number for 2-Chloro-4-pivalamidonicotinic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-4-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid (CAS 1021339-24-1) is a chemical compound with the molecular formula C11H13ClN2O3 and a molecular weight of 256.68 g/mol. IUPAC name: 2-chloro-4-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid. InChIKey: FOGOGWIZSINXEC-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O3 |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | 2-chloro-4-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid |
| InChIKey | FOGOGWIZSINXEC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C(=NC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)