cas: 207405-59-2 — see every product listed under this CAS number, including other names
tert-Butyl 6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate 96% (CAS 207405-59-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A161570-250mg |
| cas | 207405-59-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 242.44 Pln | |
| Ambeed | 5g | 915.50 Pln | |
| Ambeed | 10g | 1749.88 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A161570 |
Tert-butyl 6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 207405-59-2) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl 6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: PABFVGKPNHVSCG-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl 6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | PABFVGKPNHVSCG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CC1C(C2)O |
Computed by PubChem (NCBI)