cas: 384793-17-3 — see every product listed under this CAS number, including other names
tert-Butyl N-(2-bromo-5-chlorophenyl)carbamate, 98% (CAS 384793-17-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1063281-100mg |
| cas | 384793-17-3 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 545.23 Pln | |
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 440.49 Pln | |
| Fluorochem | 1g | 924.69 Pln | |
| Fluorochem | 5g | 2934.40 Pln | |
| Fluorochem | 10g | 4048.59 Pln | |
| Fluorochem | 25g | 8448.08 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-(2-bromo-5-chlorophenyl)carbamate (CAS 384793-17-3) is a chemical compound with the molecular formula C11H13BrClNO2 and a molecular weight of 306.58 g/mol. IUPAC name: tert-butyl N-(2-bromo-5-chlorophenyl)carbamate. InChIKey: NARMCTXFKCKBOJ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrClNO2 |
|---|---|
| Molecular weight | 306.58 g/mol |
| IUPAC name | tert-butyl N-(2-bromo-5-chlorophenyl)carbamate |
| InChIKey | NARMCTXFKCKBOJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1)Cl)Br |
Computed by PubChem (NCBI)