cas: 1035391-48-0 — see every product listed under this CAS number, including other names
tert-Butyl N-{[2-fluoro-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl}carbamate, 98%, 98% (CAS 1035391-48-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110183-100mg |
| cas | 1035391-48-0 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 683.60 Pln | |
| Chemat | 1g | 1446.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate (CAS 1035391-48-0) is a chemical compound with the molecular formula C18H27BFNO4 and a molecular weight of 351.2 g/mol. IUPAC name: tert-butyl N-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate. InChIKey: VAYYEUXFQWTMJJ-UHFFFAOYSA-N.
| Molecular formula | C18H27BFNO4 |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | tert-butyl N-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate |
| InChIKey | VAYYEUXFQWTMJJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)CNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)