cas: 121496-39-7 — see every product listed under this CAS number, including other names
tert-Butyl benzyl(2-hydroxyethyl)carbamate, 95%, 95% (CAS 121496-39-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 25g, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11263Q-100mg |
| cas | 121496-39-7 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 25g | 3040.40 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 875.60 Pln | |
| Chemat | 10g | 1552.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-benzyl-N-(2-hydroxyethyl)carbamate (CAS 121496-39-7) is a chemical compound with the molecular formula C14H21NO3 and a molecular weight of 251.32 g/mol. IUPAC name: tert-butyl N-benzyl-N-(2-hydroxyethyl)carbamate. InChIKey: LBYKHAZJINITAL-UHFFFAOYSA-N.
| Molecular formula | C14H21NO3 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | tert-butyl N-benzyl-N-(2-hydroxyethyl)carbamate |
| InChIKey | LBYKHAZJINITAL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCO)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)