cas: 1032758-87-4 — see every product listed under this CAS number, including other names
tert-Butyl methyl(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)carbamate, 97%, 97% (CAS 1032758-87-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114UKX-100mg |
| cas | 1032758-87-4 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 554.00 Pln | |
| Chemat | 5g | 1590.80 Pln | |
| Chemat | 10g | 3122.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-methyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate (CAS 1032758-87-4) is a chemical compound with the molecular formula C17H27BN2O4 and a molecular weight of 334.2 g/mol. IUPAC name: tert-butyl N-methyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate. InChIKey: QGBJKHALDLKAGX-UHFFFAOYSA-N.
| Molecular formula | C17H27BN2O4 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | tert-butyl N-methyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate |
| InChIKey | QGBJKHALDLKAGX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)