cas: 802983-66-0 — see every product listed under this CAS number, including other names
tert-Butyl methyl(pyrrolidin-3-ylmethyl)carbamate, 95+%, 95+% (CAS 802983-66-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116N3S-250mg |
| cas | 802983-66-0 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 1g | 1125.20 Pln | |
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 5g | 3131.60 Pln | |
| Chemat | 10g | 5378.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-methyl-N-(pyrrolidin-3-ylmethyl)carbamate (CAS 802983-66-0) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-methyl-N-(pyrrolidin-3-ylmethyl)carbamate. InChIKey: ICTZUPNLSITARI-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-methyl-N-(pyrrolidin-3-ylmethyl)carbamate |
| InChIKey | ICTZUPNLSITARI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CC1CCNC1 |
Computed by PubChem (NCBI)