cas: 873537-32-7 — see every product listed under this CAS number, including other names
tert-Butyl trans-4-cyanocyclohexylcarbamate, 97% (CAS 873537-32-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F095664-100MG |
| cas | 873537-32-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 346.77 Pln | |
| Fluorochem | 1g | 903.87 Pln | |
| Fluorochem | 5g | 3574.80 Pln | |
| Fluorochem | 10g | 6245.74 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(4-cyanocyclohexyl)carbamate (CAS 873537-32-7) is a chemical compound with the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. IUPAC name: tert-butyl N-(4-cyanocyclohexyl)carbamate. InChIKey: QHZJRHRMFIDRFL-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O2 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | tert-butyl N-(4-cyanocyclohexyl)carbamate |
| InChIKey | QHZJRHRMFIDRFL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)C#N |
Computed by PubChem (NCBI)