cas: 181308-57-6 — see every product listed under this CAS number, including other names
tert-Butyl trans-4-formylcyclohexylcarbamate, 95% (CAS 181308-57-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F984510-100MG |
| cas | 181308-57-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 96.86 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 2.5g | 409.25 Pln | |
| Fluorochem | 5g | 560.24 Pln | |
| Fluorochem | 10g | 987.17 Pln | |
| Fluorochem | 25g | 1908.72 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(4-formylcyclohexyl)carbamate (CAS 181308-57-6) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl N-(4-formylcyclohexyl)carbamate. InChIKey: GPDBIGSFXXKWQR-UHFFFAOYSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl N-(4-formylcyclohexyl)carbamate |
| InChIKey | GPDBIGSFXXKWQR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)C=O |
Computed by PubChem (NCBI)