cas: 1893408-11-1 — see every product listed under this CAS number, including other names
tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate, 97%, 97% (CAS 1893408-11-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JU6G-100mg |
| cas | 1893408-11-1 |
| size | 100mg |
| availability | 7.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 500mg | 501.20 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2747.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate (CAS 1893408-11-1) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate. InChIKey: GISYXRBCSOIMTM-ZETCQYMHSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate |
| InChIKey | GISYXRBCSOIMTM-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C(C1)(F)F)O |
Computed by PubChem (NCBI)