cas: 2381496-92-8 — see every product listed under this CAS number, including other names
tert-butyl (7R)-7-hydroxy-5-azaspiro[2.4]heptane-5-carboxylate, 97% (CAS 2381496-92-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F874794-100MG |
| cas | 2381496-92-8 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1304.77 Pln | |
| Fluorochem | 250mg | 2273.18 Pln | |
| Fluorochem | 500mg | 3215.55 Pln | |
| Fluorochem | 1g | 5527.24 Pln | |
| Fluorochem | 5g | 16101.64 Pln | |
| Chemat | 100mg | 726.80 Pln | |
| Chemat | 250mg | 1221.20 Pln | |
| Chemat | 500mg | 1917.20 Pln | |
| Chemat | 1g | 2963.60 Pln | |
| Chemat | 5g | 8685.20 Pln | |
| Chemat | 10g | 16773.20 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Tert-butyl (7R)-7-hydroxy-5-azaspiro[2.4]heptane-5-carboxylate (CAS 2381496-92-8) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl (7R)-7-hydroxy-5-azaspiro[2.4]heptane-5-carboxylate. InChIKey: JIDGHBGXDMQQFD-QMMMGPOBSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl (7R)-7-hydroxy-5-azaspiro[2.4]heptane-5-carboxylate |
| InChIKey | JIDGHBGXDMQQFD-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C2(C1)CC2)O |
Computed by PubChem (NCBI)