cas: 1000800-90-7 — see every product listed under this CAS number, including other names
tert-butyl 2,4-dioxo-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridine-1-carboxylate, 97% (CAS 1000800-90-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12Z0AQ-100mg |
| cas | 1000800-90-7 |
| size | 100mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 870.80 Pln | |
| Chemat | 250mg | 1350.80 Pln | |
| Chemat | 500mg | 2205.20 Pln | |
| Chemat | 1g | 3280.40 Pln | |
| Chemat | 5g | 9712.40 Pln | |
| Fluorochem | 100mg | 1617.16 Pln | |
| Fluorochem | 250mg | 2512.67 Pln | |
| Fluorochem | 500mg | 4079.83 Pln | |
| Fluorochem | 1g | 6084.33 Pln | |
| Fluorochem | 5g | 17736.48 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2,4-dioxo-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridine-1-carboxylate (CAS 1000800-90-7) is a chemical compound with the molecular formula C13H19NO4 and a molecular weight of 253.29 g/mol. IUPAC name: tert-butyl 2,4-dioxo-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridine-1-carboxylate. InChIKey: CZPCMWRYIGSHBW-UHFFFAOYSA-N.
| Molecular formula | C13H19NO4 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | tert-butyl 2,4-dioxo-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridine-1-carboxylate |
| InChIKey | CZPCMWRYIGSHBW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCCC2C(=O)CC1=O |
Computed by PubChem (NCBI)