cas: 1346674-11-0 — see every product listed under this CAS number, including other names
tert-butyl 3-(5-amino-1H-pyrazol-3-yl)azetidine-1-carboxylate, 98% (CAS 1346674-11-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F794124-100MG |
| cas | 1346674-11-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1882.69 Pln | |
| Fluorochem | 250mg | 2976.05 Pln | |
| Fluorochem | 500mg | 4923.28 Pln | |
| Fluorochem | 1g | 7359.93 Pln | |
| Fluorochem | 5g | 21969.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-(3-amino-1H-pyrazol-5-yl)azetidine-1-carboxylate (CAS 1346674-11-0) is a chemical compound with the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. IUPAC name: tert-butyl 3-(3-amino-1H-pyrazol-5-yl)azetidine-1-carboxylate. InChIKey: HUWAVFVZXBJKPT-UHFFFAOYSA-N.
| Molecular formula | C11H18N4O2 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | tert-butyl 3-(3-amino-1H-pyrazol-5-yl)azetidine-1-carboxylate |
| InChIKey | HUWAVFVZXBJKPT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C2=CC(=NN2)N |
Computed by PubChem (NCBI)