cas: 630119-99-2 — see every product listed under this CAS number, including other names
tert-butyl 4-hydroxy-4-(thiophen-2-yl)piperidine-1-carboxylate, 97%, 97% (CAS 630119-99-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120F2H-100mg |
| cas | 630119-99-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 242.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-hydroxy-4-thiophen-2-ylpiperidine-1-carboxylate (CAS 630119-99-2) is a chemical compound with the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. IUPAC name: tert-butyl 4-hydroxy-4-thiophen-2-ylpiperidine-1-carboxylate. InChIKey: LWEUZOXYUOEMQN-UHFFFAOYSA-N.
| Molecular formula | C14H21NO3S |
|---|---|
| Molecular weight | 283.39 g/mol |
| IUPAC name | tert-butyl 4-hydroxy-4-thiophen-2-ylpiperidine-1-carboxylate |
| InChIKey | LWEUZOXYUOEMQN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C2=CC=CS2)O |
Computed by PubChem (NCBI)