CAS 1820576-01-9 is the registry number for methyl (2S)-2-amino-3-{[(4-methoxyphenyl)methyl]sulfanyl}-3-methylbutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl (2S)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methylbutanoate (CAS 1820576-01-9) is a chemical compound with the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. IUPAC name: methyl (2S)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methylbutanoate. InChIKey: JUSFSHVUKUYSMK-LBPRGKRZSA-N.
| Molecular formula | C14H21NO3S |
|---|---|
| Molecular weight | 283.39 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methylbutanoate |
| InChIKey | JUSFSHVUKUYSMK-LBPRGKRZSA-N |
| SMILES | CC(C)([C@H](C(=O)OC)N)SCC1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)