cas: 186202-73-3 — see every product listed under this CAS number, including other names
tert-butyl 5-benzylhexahydropyrrolo[3,4-c]pyrrole-2(1H)-carboxylate (CAS 186202-73-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ANJB-50mg |
| cas | 186202-73-3 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 170.00 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 1187.60 Pln |
| delivery time | 3 weeks |
|---|
Tert-butyl 2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (CAS 186202-73-3) is a chemical compound with the molecular formula C18H26N2O2 and a molecular weight of 302.4 g/mol. IUPAC name: tert-butyl 2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate. InChIKey: WUEVXPVJRUPJLC-UHFFFAOYSA-N.
| Molecular formula | C18H26N2O2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | tert-butyl 2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| InChIKey | WUEVXPVJRUPJLC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CN(CC2C1)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)